C27H44O7 — CID 154107750
tris(1-methylcyclohexyl) 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 154107750) has the molecular formula C27H44O7 and a molecular weight of 480.64 g/mol. Its IUPAC name is tris(1-methylcyclohexyl) 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | tris(1-methylcyclohexyl) 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 154107750 |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | tris(1-methylcyclohexyl) 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CC1(OC(=O)CC(O)(CC(=O)OC2(C)CCCCC2)C(=O)OC2(C)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C27H44O7/c1-24(13-7-4-8-14-24)32-21(28)19-27(31,23(30)34-26(3)17-11-6-12-18-26)20-22(29)33-25(2)15-9-5-10-16-25/h31H,4-20H2,1-3H3 |
| InChIKey | UDHNDIKKYBVPFI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|