C26H46O4 — CID 141067739
bis(1-methyl-4-propan-2-ylcyclohexyl) 2,2-dimethylbutanedioate (PubChem CID 141067739) has the molecular formula C26H46O4 and a molecular weight of 422.65 g/mol. Its IUPAC name is bis(1-methyl-4-propan-2-ylcyclohexyl) 2,2-dimethylbutanedioate.
| Compound Name | bis(1-methyl-4-propan-2-ylcyclohexyl) 2,2-dimethylbutanedioate |
|---|---|
| PubChem CID | 141067739 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | bis(1-methyl-4-propan-2-ylcyclohexyl) 2,2-dimethylbutanedioate |
| SMILES | CC(C)C1CCC(C)(OC(=O)CC(C)(C)C(=O)OC2(C)CCC(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C26H46O4/c1-18(2)20-9-13-25(7,14-10-20)29-22(27)17-24(5,6)23(28)30-26(8)15-11-21(12-16-26)19(3)4/h18-21H,9-17H2,1-8H3 |
| InChIKey | NIMCRVCNKGFLJF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |