C14H19F7O2 — CID 20979558
(1-methyl-4-propan-2-ylcyclohexyl) 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 20979558) has the molecular formula C14H19F7O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is (1-methyl-4-propan-2-ylcyclohexyl) 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (1-methyl-4-propan-2-ylcyclohexyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 20979558 |
| Molecular Formula | C14H19F7O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (1-methyl-4-propan-2-ylcyclohexyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(C)C1CCC(C)(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F7O2/c1-8(2)9-4-6-11(3,7-5-9)23-10(22)12(15,16)13(17,18)14(19,20)21/h8-9H,4-7H2,1-3H3 |
| InChIKey | LMFQOMFUPFBVKH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|