C38H66F6O6 — CID 162021258
(1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-methylbutyl) 2,2-dimethylbutanoate;3,3-dimethyl-2-(2,2,2-trifluoroethoxy)pent-1-ene;(1-methylcyclopentyl) 2,2-dimethylbutanoate (PubChem CID 162021258) has the molecular formula C38H66F6O6 and a molecular weight of 732.93 g/mol. Its IUPAC name is (1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-methylbutyl) 2,2-dimethylbutanoate;3,3-dimethyl-2-(2,2,2-trifluoroethoxy)pent-1-ene;(1-methylcyclopentyl) 2,2-dimethylbutanoate.
| Compound Name | (1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-methylbutyl) 2,2-dimethylbutanoate;3,3-dimethyl-2-(2,2,2-trifluoroethoxy)pent-1-ene;(1-methylcyclopentyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 162021258 |
| Molecular Formula | C38H66F6O6 |
| Molecular Weight | 732.93 g/mol |
| Exact Mass | 732.48 |
| IUPAC Name | (1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-methylbutyl) 2,2-dimethylbutanoate;3,3-dimethyl-2-(2,2,2-trifluoroethoxy)pent-1-ene;(1-methylcyclopentyl) 2,2-dimethylbutanoate |
| SMILES | C=C(OCC(F)(F)F)C(C)(C)CC.CCC(C)(C)C(=O)OC(CC(C)(O)C(F)(F)F)C1CCCCC1.CCC(C)(C)C(=O)OC1(C)CCCC1 |
| InChI | InChI=1S/C17H29F3O3.C12H22O2.C9H15F3O/c1-5-15(2,3)14(21)23-13(12-9-7-6-8-10-12)11-16(4,22)17(18,19)20;1-5-11(2,3)10(13)14-12(4)8-6-7-9-12;1-5-8(3,4)7(2)13-6-9(10,11)12/h12-13,22H,5-11H2,1-4H3;5-9H2,1-4H3;2,5-6H2,1,3-4H3 |
| InChIKey | YUTXIOWTGQINBS-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.93 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|