C6H6F6O3 — CID 13141610
ethyl 2,2-difluoro-2-(1,1,2,2-tetrafluoroethoxy)acetate (PubChem CID 13141610) has the molecular formula C6H6F6O3 and a molecular weight of 240.10 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(1,1,2,2-tetrafluoroethoxy)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(1,1,2,2-tetrafluoroethoxy)acetate |
|---|---|
| PubChem CID | 13141610 |
| Molecular Formula | C6H6F6O3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | ethyl 2,2-difluoro-2-(1,1,2,2-tetrafluoroethoxy)acetate |
| SMILES | CCOC(=O)C(F)(F)OC(F)(F)C(F)F |
| InChI | InChI=1S/C6H6F6O3/c1-2-14-4(13)6(11,12)15-5(9,10)3(7)8/h3H,2H2,1H3 |
| InChIKey | YKDQBPWBNOKVKA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|