C15H26O6 — CID 88990098
diethyl 2-(2,2-dimethylpropanoyloxymethyl)-2-ethylpropanedioate (PubChem CID 88990098) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is diethyl 2-(2,2-dimethylpropanoyloxymethyl)-2-ethylpropanedioate.
| Compound Name | diethyl 2-(2,2-dimethylpropanoyloxymethyl)-2-ethylpropanedioate |
|---|---|
| PubChem CID | 88990098 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | diethyl 2-(2,2-dimethylpropanoyloxymethyl)-2-ethylpropanedioate |
| SMILES | CCOC(=O)C(CC)(COC(=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C15H26O6/c1-7-15(12(17)19-8-2,13(18)20-9-3)10-21-11(16)14(4,5)6/h7-10H2,1-6H3 |
| InChIKey | REBDHVUTKNFTQM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|