C8H20N3O2P — CID 161474918
azidomethane;ethyl 2,2-dimethylpropanoate;phosphane (PubChem CID 161474918) has the molecular formula C8H20N3O2P and a molecular weight of 221.24 g/mol. Its IUPAC name is azidomethane;ethyl 2,2-dimethylpropanoate;phosphane.
| Compound Name | azidomethane;ethyl 2,2-dimethylpropanoate;phosphane |
|---|---|
| PubChem CID | 161474918 |
| Molecular Formula | C8H20N3O2P |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | azidomethane;ethyl 2,2-dimethylpropanoate;phosphane |
| SMILES | CCOC(=O)C(C)(C)C.CN=[N+]=[N-].P |
| InChI | InChI=1S/C7H14O2.CH3N3.H3P/c1-5-9-6(8)7(2,3)4;1-3-4-2;/h5H2,1-4H3;1H3;1H3 |
| InChIKey | WDOWXDVDUXBTHV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|