C12H19IN2O4 — CID 163942816
[2-(iodocarbamoyl)-2-(methylidenecarbamoyl)butyl] 2,2-dimethylpropanoate (PubChem CID 163942816) has the molecular formula C12H19IN2O4 and a molecular weight of 382.20 g/mol. Its IUPAC name is [2-(iodocarbamoyl)-2-(methylidenecarbamoyl)butyl] 2,2-dimethylpropanoate.
| Compound Name | [2-(iodocarbamoyl)-2-(methylidenecarbamoyl)butyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163942816 |
| Molecular Formula | C12H19IN2O4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | [2-(iodocarbamoyl)-2-(methylidenecarbamoyl)butyl] 2,2-dimethylpropanoate |
| SMILES | C=NC(=O)C(CC)(COC(=O)C(C)(C)C)C(=O)NI |
| InChI | InChI=1S/C12H19IN2O4/c1-6-12(8(16)14-5,9(17)15-13)7-19-10(18)11(2,3)4/h5-7H2,1-4H3,(H,15,17) |
| InChIKey | RSMJIZFSVXZNNF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|