C13H21F3O4 — CID 103973022
diethyl 2-ethyl-2-(4,4,4-trifluorobutyl)propanedioate (PubChem CID 103973022) has the molecular formula C13H21F3O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is diethyl 2-ethyl-2-(4,4,4-trifluorobutyl)propanedioate.
| Compound Name | diethyl 2-ethyl-2-(4,4,4-trifluorobutyl)propanedioate |
|---|---|
| PubChem CID | 103973022 |
| Molecular Formula | C13H21F3O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | diethyl 2-ethyl-2-(4,4,4-trifluorobutyl)propanedioate |
| SMILES | CCOC(=O)C(CC)(CCCC(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C13H21F3O4/c1-4-12(10(17)19-5-2,11(18)20-6-3)8-7-9-13(14,15)16/h4-9H2,1-3H3 |
| InChIKey | SZPXPWNFECFPAF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|