C11H17F3O4 — CID 103974106
2-ethoxycarbonyl-5,5,5-trifluoro-2-propylpentanoic acid (PubChem CID 103974106) has the molecular formula C11H17F3O4 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-ethoxycarbonyl-5,5,5-trifluoro-2-propylpentanoic acid.
| Compound Name | 2-ethoxycarbonyl-5,5,5-trifluoro-2-propylpentanoic acid |
|---|---|
| PubChem CID | 103974106 |
| Molecular Formula | C11H17F3O4 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-ethoxycarbonyl-5,5,5-trifluoro-2-propylpentanoic acid |
| SMILES | CCCC(CCC(F)(F)F)(C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C11H17F3O4/c1-3-5-10(8(15)16,9(17)18-4-2)6-7-11(12,13)14/h3-7H2,1-2H3,(H,15,16) |
| InChIKey | VQHLFNXBPCMCAB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|