C12H22O6S — CID 113360390
2-ethoxycarbonyl-4-methyl-2-(2-methylsulfonylethyl)pentanoic acid (PubChem CID 113360390) has the molecular formula C12H22O6S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4-methyl-2-(2-methylsulfonylethyl)pentanoic acid.
| Compound Name | 2-ethoxycarbonyl-4-methyl-2-(2-methylsulfonylethyl)pentanoic acid |
|---|---|
| PubChem CID | 113360390 |
| Molecular Formula | C12H22O6S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-ethoxycarbonyl-4-methyl-2-(2-methylsulfonylethyl)pentanoic acid |
| SMILES | CCOC(=O)C(CCS(C)(=O)=O)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H22O6S/c1-5-18-11(15)12(10(13)14,8-9(2)3)6-7-19(4,16)17/h9H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | GAWBABDCBABOSC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|