C25H44O8 — CID 162400182
2,2-bis(7-ethoxy-6,6-dimethyl-7-oxoheptyl)propanedioic acid (PubChem CID 162400182) has the molecular formula C25H44O8 and a molecular weight of 472.62 g/mol. Its IUPAC name is 2,2-bis(7-ethoxy-6,6-dimethyl-7-oxoheptyl)propanedioic acid.
| Compound Name | 2,2-bis(7-ethoxy-6,6-dimethyl-7-oxoheptyl)propanedioic acid |
|---|---|
| PubChem CID | 162400182 |
| Molecular Formula | C25H44O8 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 2,2-bis(7-ethoxy-6,6-dimethyl-7-oxoheptyl)propanedioic acid |
| SMILES | CCOC(=O)C(C)(C)CCCCCC(CCCCCC(C)(C)C(=O)OCC)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C25H44O8/c1-7-32-21(30)23(3,4)15-11-9-13-17-25(19(26)27,20(28)29)18-14-10-12-16-24(5,6)22(31)33-8-2/h7-18H2,1-6H3,(H,26,27)(H,28,29) |
| InChIKey | VFKPQEFFRHXBPT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|