C22H38O3 — CID 158421482
ethyl 2,2,14,14-tetramethyl-15-oxohexadec-7-ynoate (PubChem CID 158421482) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is ethyl 2,2,14,14-tetramethyl-15-oxohexadec-7-ynoate.
| Compound Name | ethyl 2,2,14,14-tetramethyl-15-oxohexadec-7-ynoate |
|---|---|
| PubChem CID | 158421482 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | ethyl 2,2,14,14-tetramethyl-15-oxohexadec-7-ynoate |
| SMILES | CCOC(=O)C(C)(C)CCCCC#CCCCCCC(C)(C)C(C)=O |
| InChI | InChI=1S/C22H38O3/c1-7-25-20(24)22(5,6)18-16-14-12-10-8-9-11-13-15-17-21(3,4)19(2)23/h7,9,11-18H2,1-6H3 |
| InChIKey | AKPCMGYFMWSHQL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|