C28H50O7 — CID 118372684
2-[2-(2,2,6,6-tetramethyl-7-oxooctanoyl)oxyethoxy]ethyl 2,2,6,6-tetramethyl-7-oxooctanoate (PubChem CID 118372684) has the molecular formula C28H50O7 and a molecular weight of 498.70 g/mol. Its IUPAC name is 2-[2-(2,2,6,6-tetramethyl-7-oxooctanoyl)oxyethoxy]ethyl 2,2,6,6-tetramethyl-7-oxooctanoate.
| Compound Name | 2-[2-(2,2,6,6-tetramethyl-7-oxooctanoyl)oxyethoxy]ethyl 2,2,6,6-tetramethyl-7-oxooctanoate |
|---|---|
| PubChem CID | 118372684 |
| Molecular Formula | C28H50O7 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | 2-[2-(2,2,6,6-tetramethyl-7-oxooctanoyl)oxyethoxy]ethyl 2,2,6,6-tetramethyl-7-oxooctanoate |
| SMILES | CC(=O)C(C)(C)CCCC(C)(C)C(=O)OCCOCCOC(=O)C(C)(C)CCCC(C)(C)C(C)=O |
| InChI | InChI=1S/C28H50O7/c1-21(29)25(3,4)13-11-15-27(7,8)23(31)34-19-17-33-18-20-35-24(32)28(9,10)16-12-14-26(5,6)22(2)30/h11-20H2,1-10H3 |
| InChIKey | OITYWBIGGVJOFS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|