C30H54O10 — CID 175062622
bis[3-[2-(2,2-dimethylpropoxy)ethoxy]-2,2-dimethyl-3-oxopropyl] hexanedioate (PubChem CID 175062622) has the molecular formula C30H54O10 and a molecular weight of 574.75 g/mol. Its IUPAC name is bis[3-[2-(2,2-dimethylpropoxy)ethoxy]-2,2-dimethyl-3-oxopropyl] hexanedioate.
| Compound Name | bis[3-[2-(2,2-dimethylpropoxy)ethoxy]-2,2-dimethyl-3-oxopropyl] hexanedioate |
|---|---|
| PubChem CID | 175062622 |
| Molecular Formula | C30H54O10 |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | bis[3-[2-(2,2-dimethylpropoxy)ethoxy]-2,2-dimethyl-3-oxopropyl] hexanedioate |
| SMILES | CC(C)(C)COCCOC(=O)C(C)(C)COC(=O)CCCCC(=O)OCC(C)(C)C(=O)OCCOCC(C)(C)C |
| InChI | InChI=1S/C30H54O10/c1-27(2,3)19-35-15-17-37-25(33)29(7,8)21-39-23(31)13-11-12-14-24(32)40-22-30(9,10)26(34)38-18-16-36-20-28(4,5)6/h11-22H2,1-10H3 |
| InChIKey | NITCJABUUIDMOO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|