C30H48O10 — CID 165366272
[3-[2,2-dimethyl-3-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]propanoyl]oxy-2,2-dimethylpropyl] 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 165366272) has the molecular formula C30H48O10 and a molecular weight of 568.70 g/mol. Its IUPAC name is [3-[2,2-dimethyl-3-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]propanoyl]oxy-2,2-dimethylpropyl] 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | [3-[2,2-dimethyl-3-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]propanoyl]oxy-2,2-dimethylpropyl] 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 165366272 |
| Molecular Formula | C30H48O10 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | [3-[2,2-dimethyl-3-[6-(2-methylprop-2-enoyloxy)hexanoyloxy]propanoyl]oxy-2,2-dimethylpropyl] 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)OCC(C)(C)COC(=O)C(C)(C)COC(=O)CCCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C30H48O10/c1-22(2)26(33)36-17-13-9-11-15-24(31)38-19-29(5,6)20-40-28(35)30(7,8)21-39-25(32)16-12-10-14-18-37-27(34)23(3)4/h1,3,9-21H2,2,4-8H3 |
| InChIKey | SDMULKKYZYGTCF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|