C17H32O6 — CID 175013288
6-O-[2-(2,2-dimethylpropoxy)ethyl] 1-O-(4-hydroxybutyl) hexanedioate (PubChem CID 175013288) has the molecular formula C17H32O6 and a molecular weight of 332.44 g/mol. Its IUPAC name is 6-O-[2-(2,2-dimethylpropoxy)ethyl] 1-O-(4-hydroxybutyl) hexanedioate.
| Compound Name | 6-O-[2-(2,2-dimethylpropoxy)ethyl] 1-O-(4-hydroxybutyl) hexanedioate |
|---|---|
| PubChem CID | 175013288 |
| Molecular Formula | C17H32O6 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 6-O-[2-(2,2-dimethylpropoxy)ethyl] 1-O-(4-hydroxybutyl) hexanedioate |
| SMILES | CC(C)(C)COCCOC(=O)CCCCC(=O)OCCCCO |
| InChI | InChI=1S/C17H32O6/c1-17(2,3)14-21-12-13-23-16(20)9-5-4-8-15(19)22-11-7-6-10-18/h18H,4-14H2,1-3H3 |
| InChIKey | LDSYMSRAQFZINQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|