C53H92O20 — CID 139240612
[6-[3-[6-(6-hydroxyhexanoyloxy)hexanoyloxy]-2,2-bis[6-(6-hydroxyhexanoyloxy)hexanoyloxymethyl]propoxy]-6-oxohexyl] 6-hydroxyhexanoate (PubChem CID 139240612) has the molecular formula C53H92O20 and a molecular weight of 1049.30 g/mol. Its IUPAC name is [6-[3-[6-(6-hydroxyhexanoyloxy)hexanoyloxy]-2,2-bis[6-(6-hydroxyhexanoyloxy)hexanoyloxymethyl]propoxy]-6-oxohexyl] 6-hydroxyhexanoate.
| Compound Name | [6-[3-[6-(6-hydroxyhexanoyloxy)hexanoyloxy]-2,2-bis[6-(6-hydroxyhexanoyloxy)hexanoyloxymethyl]propoxy]-6-oxohexyl] 6-hydroxyhexanoate |
|---|---|
| PubChem CID | 139240612 |
| Molecular Formula | C53H92O20 |
| Molecular Weight | 1049.30 g/mol |
| Exact Mass | 1048.62 |
| IUPAC Name | [6-[3-[6-(6-hydroxyhexanoyloxy)hexanoyloxy]-2,2-bis[6-(6-hydroxyhexanoyloxy)hexanoyloxymethyl]propoxy]-6-oxohexyl] 6-hydroxyhexanoate |
| SMILES | O=C(CCCCCO)OCCCCCC(=O)OCC(COC(=O)CCCCCOC(=O)CCCCCO)(COC(=O)CCCCCOC(=O)CCCCCO)COC(=O)CCCCCOC(=O)CCCCCO |
| InChI | InChI=1S/C53H92O20/c54-33-17-1-9-25-45(58)66-37-21-5-13-29-49(62)70-41-53(42-71-50(63)30-14-6-22-38-67-46(59)26-10-2-18-34-55,43-72-51(64)31-15-7-23-39-68-47(60)27-11-3-19-35-56)44-73-52(65)32-16-8-24-40-69-48(61)28-12-4-20-36-57/h54-57H,1-44H2 |
| InChIKey | KEVFJKBIWYWVDB-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 291.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.30 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|