C16H28Cl2O4 — CID 19745520
2-(5-chloro-2,2-dimethylpentanoyl)oxyethyl 5-chloro-2,2-dimethylpentanoate (PubChem CID 19745520) has the molecular formula C16H28Cl2O4 and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-(5-chloro-2,2-dimethylpentanoyl)oxyethyl 5-chloro-2,2-dimethylpentanoate.
| Compound Name | 2-(5-chloro-2,2-dimethylpentanoyl)oxyethyl 5-chloro-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 19745520 |
| Molecular Formula | C16H28Cl2O4 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-(5-chloro-2,2-dimethylpentanoyl)oxyethyl 5-chloro-2,2-dimethylpentanoate |
| SMILES | CC(C)(CCCCl)C(=O)OCCOC(=O)C(C)(C)CCCCl |
| InChI | InChI=1S/C16H28Cl2O4/c1-15(2,7-5-9-17)13(19)21-11-12-22-14(20)16(3,4)8-6-10-18/h5-12H2,1-4H3 |
| InChIKey | MUAIMVMLAIRKHG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|