C20H37BrO5 — CID 145082384
ethyl 6-[2-(6-bromo-2,2-dimethylhexanoyl)oxyethoxy]-2,2-dimethylhexanoate (PubChem CID 145082384) has the molecular formula C20H37BrO5 and a molecular weight of 437.42 g/mol. Its IUPAC name is ethyl 6-[2-(6-bromo-2,2-dimethylhexanoyl)oxyethoxy]-2,2-dimethylhexanoate.
| Compound Name | ethyl 6-[2-(6-bromo-2,2-dimethylhexanoyl)oxyethoxy]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 145082384 |
| Molecular Formula | C20H37BrO5 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | ethyl 6-[2-(6-bromo-2,2-dimethylhexanoyl)oxyethoxy]-2,2-dimethylhexanoate |
| SMILES | CCOC(=O)C(C)(C)CCCCOCCOC(=O)C(C)(C)CCCCBr |
| InChI | InChI=1S/C20H37BrO5/c1-6-25-17(22)19(2,3)12-8-10-14-24-15-16-26-18(23)20(4,5)11-7-9-13-21/h6-16H2,1-5H3 |
| InChIKey | XGMOPEHBMXDQHQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|