C17H25BrO3 — CID 121269614
ethyl 6-[2-(bromomethyl)phenoxy]-2,2-dimethylhexanoate (PubChem CID 121269614) has the molecular formula C17H25BrO3 and a molecular weight of 357.29 g/mol. Its IUPAC name is ethyl 6-[2-(bromomethyl)phenoxy]-2,2-dimethylhexanoate.
| Compound Name | ethyl 6-[2-(bromomethyl)phenoxy]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 121269614 |
| Molecular Formula | C17H25BrO3 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | ethyl 6-[2-(bromomethyl)phenoxy]-2,2-dimethylhexanoate |
| SMILES | CCOC(=O)C(C)(C)CCCCOc1ccccc1CBr |
| InChI | InChI=1S/C17H25BrO3/c1-4-20-16(19)17(2,3)11-7-8-12-21-15-10-6-5-9-14(15)13-18/h5-6,9-10H,4,7-8,11-13H2,1-3H3 |
| InChIKey | YHEPKWLXXQNBJG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|