C27H39NO5 — CID 14327286
ethyl 2,2-dimethyl-6-[4-[5-(pyridin-2-ylmethoxy)pentoxy]phenoxy]hexanoate (PubChem CID 14327286) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-6-[4-[5-(pyridin-2-ylmethoxy)pentoxy]phenoxy]hexanoate.
| Compound Name | ethyl 2,2-dimethyl-6-[4-[5-(pyridin-2-ylmethoxy)pentoxy]phenoxy]hexanoate |
|---|---|
| PubChem CID | 14327286 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | ethyl 2,2-dimethyl-6-[4-[5-(pyridin-2-ylmethoxy)pentoxy]phenoxy]hexanoate |
| SMILES | CCOC(=O)C(C)(C)CCCCOc1ccc(OCCCCCOCc2ccccn2)cc1 |
| InChI | InChI=1S/C27H39NO5/c1-4-31-26(29)27(2,3)17-7-11-21-33-25-15-13-24(14-16-25)32-20-10-5-9-19-30-22-23-12-6-8-18-28-23/h6,8,12-16,18H,4-5,7,9-11,17,19-22H2,1-3H3 |
| InChIKey | OQSBVKOYHUVZDS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|