C19H30N2O4 — CID 10545816
diethyl 2-methyl-2-[4-[methyl(pyridin-2-ylmethyl)amino]butyl]propanedioate (PubChem CID 10545816) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is diethyl 2-methyl-2-[4-[methyl(pyridin-2-ylmethyl)amino]butyl]propanedioate.
| Compound Name | diethyl 2-methyl-2-[4-[methyl(pyridin-2-ylmethyl)amino]butyl]propanedioate |
|---|---|
| PubChem CID | 10545816 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | diethyl 2-methyl-2-[4-[methyl(pyridin-2-ylmethyl)amino]butyl]propanedioate |
| SMILES | CCOC(=O)C(C)(CCCCN(C)Cc1ccccn1)C(=O)OCC |
| InChI | InChI=1S/C19H30N2O4/c1-5-24-17(22)19(3,18(23)25-6-2)12-8-10-14-21(4)15-16-11-7-9-13-20-16/h7,9,11,13H,5-6,8,10,12,14-15H2,1-4H3 |
| InChIKey | SOQMHARVSYHXLE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|