ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate

C11H20O2S2 — CID 141454866

IUPACethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate
SMILESCCOC(=O)C(C)(C)CCCC(=S)SC
InChIInChI=1S/C11H20O2S2/c1-5-13-10(12)11(2,3)8-6-7-9(14)15-4/h5-8H2,1-4H3
InChIKeyXFRTWTMBVKSOCA-UHFFFAOYSA-N
MW248.41 g/mol
LogP3.44
Rot. Bonds6

About ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate

ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate (PubChem CID 141454866) has the molecular formula C11H20O2S2 and a molecular weight of 248.41 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate.

Molecular Properties

Compound Nameethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate
PubChem CID141454866
Molecular FormulaC11H20O2S2
Molecular Weight248.41 g/mol
Exact Mass248.09
IUPAC Nameethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate
SMILESCCOC(=O)C(C)(C)CCCC(=S)SC
InChIInChI=1S/C11H20O2S2/c1-5-13-10(12)11(2,3)8-6-7-9(14)15-4/h5-8H2,1-4H3
InChIKeyXFRTWTMBVKSOCA-UHFFFAOYSA-N
XLogP3.44
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.41
LogP ≤ 53.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate?
The IUPAC name of ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate (CID 141454866) is ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate.
What is the SMILES notation for ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate?
The canonical SMILES for ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate is CCOC(=O)C(C)(C)CCCC(=S)SC.
What is the InChIKey of ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate?
The InChIKey is XFRTWTMBVKSOCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S2/c1-5-13-10(12)11(2,3)8-6-7-9(14)15-4/h5-8H2,1-4H3.
What are the key properties of ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate?
ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate has a molecular weight of 248.41 g/mol, XLogP of 3.44, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate is sourced from PubChem (CID 141454866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).