C11H20O2S2 — CID 141454866
ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate (PubChem CID 141454866) has the molecular formula C11H20O2S2 and a molecular weight of 248.41 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate.
| Compound Name | ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate |
|---|---|
| PubChem CID | 141454866 |
| Molecular Formula | C11H20O2S2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | ethyl 2,2-dimethyl-6-methylsulfanyl-6-sulfanylidenehexanoate |
| SMILES | CCOC(=O)C(C)(C)CCCC(=S)SC |
| InChI | InChI=1S/C11H20O2S2/c1-5-13-10(12)11(2,3)8-6-7-9(14)15-4/h5-8H2,1-4H3 |
| InChIKey | XFRTWTMBVKSOCA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|