C12H8BrF5O — CID 113336755
2-bromo-1-cyclopropyl-3-(2,3,4,5,6-pentafluorophenyl)propan-1-one (PubChem CID 113336755) has the molecular formula C12H8BrF5O and a molecular weight of 343.09 g/mol. Its IUPAC name is 2-bromo-1-cyclopropyl-3-(2,3,4,5,6-pentafluorophenyl)propan-1-one.
| Compound Name | 2-bromo-1-cyclopropyl-3-(2,3,4,5,6-pentafluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 113336755 |
| Molecular Formula | C12H8BrF5O |
| Molecular Weight | 343.09 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 2-bromo-1-cyclopropyl-3-(2,3,4,5,6-pentafluorophenyl)propan-1-one |
| SMILES | O=C(C(Br)Cc1c(F)c(F)c(F)c(F)c1F)C1CC1 |
| InChI | InChI=1S/C12H8BrF5O/c13-6(12(19)4-1-2-4)3-5-7(14)9(16)11(18)10(17)8(5)15/h4,6H,1-3H2 |
| InChIKey | BEDOWGFKILNWDC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.09 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|