C12H11Br2FO — CID 65436242
2-bromo-3-(4-bromo-3-fluorophenyl)-1-cyclopropylpropan-1-one (PubChem CID 65436242) has the molecular formula C12H11Br2FO and a molecular weight of 350.03 g/mol. Its IUPAC name is 2-bromo-3-(4-bromo-3-fluorophenyl)-1-cyclopropylpropan-1-one.
| Compound Name | 2-bromo-3-(4-bromo-3-fluorophenyl)-1-cyclopropylpropan-1-one |
|---|---|
| PubChem CID | 65436242 |
| Molecular Formula | C12H11Br2FO |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 347.92 |
| IUPAC Name | 2-bromo-3-(4-bromo-3-fluorophenyl)-1-cyclopropylpropan-1-one |
| SMILES | O=C(C(Br)Cc1ccc(Br)c(F)c1)C1CC1 |
| InChI | InChI=1S/C12H11Br2FO/c13-9-4-1-7(6-11(9)15)5-10(14)12(16)8-2-3-8/h1,4,6,8,10H,2-3,5H2 |
| InChIKey | DDAHUHQKWLVWIK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|