C12H12F5NO — CID 123963146
2-(methylamino)-1-(2,3,4,5,6-pentafluorophenyl)pentan-3-one (PubChem CID 123963146) has the molecular formula C12H12F5NO and a molecular weight of 281.22 g/mol. Its IUPAC name is 2-(methylamino)-1-(2,3,4,5,6-pentafluorophenyl)pentan-3-one.
| Compound Name | 2-(methylamino)-1-(2,3,4,5,6-pentafluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 123963146 |
| Molecular Formula | C12H12F5NO |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(methylamino)-1-(2,3,4,5,6-pentafluorophenyl)pentan-3-one |
| SMILES | CCC(=O)C(Cc1c(F)c(F)c(F)c(F)c1F)NC |
| InChI | InChI=1S/C12H12F5NO/c1-3-7(19)6(18-2)4-5-8(13)10(15)12(17)11(16)9(5)14/h6,18H,3-4H2,1-2H3 |
| InChIKey | QGVYTIGKNFPEEU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|