C11H22N2O2S2 — CID 137379882
(2R)-2-(methylamino)-1-[[2-(methylamino)-3-oxobutyl]disulfanyl]pentan-3-one (PubChem CID 137379882) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (2R)-2-(methylamino)-1-[[2-(methylamino)-3-oxobutyl]disulfanyl]pentan-3-one.
| Compound Name | (2R)-2-(methylamino)-1-[[2-(methylamino)-3-oxobutyl]disulfanyl]pentan-3-one |
|---|---|
| PubChem CID | 137379882 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2R)-2-(methylamino)-1-[[2-(methylamino)-3-oxobutyl]disulfanyl]pentan-3-one |
| SMILES | CCC(=O)[C@H](CSSCC(NC)C(C)=O)NC |
| InChI | InChI=1S/C11H22N2O2S2/c1-5-11(15)10(13-4)7-17-16-6-9(12-3)8(2)14/h9-10,12-13H,5-7H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | SCOCSBSCEULVKW-AXDSSHIGSA-N |
| XLogP | 1.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|