C8H17NO3 — CID 161480959
5,5-dihydroxy-3-(methylamino)pentan-2-one;ethene (PubChem CID 161480959) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 5,5-dihydroxy-3-(methylamino)pentan-2-one;ethene.
| Compound Name | 5,5-dihydroxy-3-(methylamino)pentan-2-one;ethene |
|---|---|
| PubChem CID | 161480959 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 5,5-dihydroxy-3-(methylamino)pentan-2-one;ethene |
| SMILES | C=C.CNC(CC(O)O)C(C)=O |
| InChI | InChI=1S/C6H13NO3.C2H4/c1-4(8)5(7-2)3-6(9)10;1-2/h5-7,9-10H,3H2,1-2H3;1-2H2 |
| InChIKey | WEIQDIMEKLTSRN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|