About CID 166448994
CID 166448994 (PubChem CID 166448994) has the molecular formula C6H10F2NO
and a molecular weight of 150.15 g/mol.
Molecular Properties
| Compound Name | CID 166448994 |
| PubChem CID | 166448994 |
| Molecular Formula | C6H10F2NO |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | — |
| SMILES | CNC(C[C](F)F)C(C)=O |
| InChI | InChI=1S/C6H10F2NO/c1-4(10)5(9-2)3-6(7)8/h5,9H,3H2,1-2H3 |
| InChIKey | JIFNNBSTRVSEGM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 166448994 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166448994?
The IUPAC name of CID 166448994 (CID 166448994) is not available.
What is the SMILES notation for CID 166448994?
The canonical SMILES for CID 166448994 is CNC(C[C](F)F)C(C)=O.
What is the InChIKey of CID 166448994?
The InChIKey is JIFNNBSTRVSEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2NO/c1-4(10)5(9-2)3-6(7)8/h5,9H,3H2,1-2H3.
What are the key properties of CID 166448994?
CID 166448994 has a molecular weight of 150.15 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166448994 is sourced from PubChem (CID 166448994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).