C9H17N3O — CID 144733150
(Z)-3,6-bis(methylamino)-5-(methylideneamino)hex-5-en-2-one (PubChem CID 144733150) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is (Z)-3,6-bis(methylamino)-5-(methylideneamino)hex-5-en-2-one.
| Compound Name | (Z)-3,6-bis(methylamino)-5-(methylideneamino)hex-5-en-2-one |
|---|---|
| PubChem CID | 144733150 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (Z)-3,6-bis(methylamino)-5-(methylideneamino)hex-5-en-2-one |
| SMILES | C=N/C(=C\NC)CC(NC)C(C)=O |
| InChI | InChI=1S/C9H17N3O/c1-7(13)9(12-4)5-8(11-3)6-10-2/h6,9-10,12H,3,5H2,1-2,4H3/b8-6- |
| InChIKey | LPJUDHJGIPXTPE-VURMDHGXSA-N |
| XLogP | 0.31 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|