C7H13N3O2 — CID 146206627
(Z,2R)-2-amino-5-(methylamino)-4-(methylideneamino)pent-4-enoic acid (PubChem CID 146206627) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is (Z,2R)-2-amino-5-(methylamino)-4-(methylideneamino)pent-4-enoic acid.
| Compound Name | (Z,2R)-2-amino-5-(methylamino)-4-(methylideneamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 146206627 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (Z,2R)-2-amino-5-(methylamino)-4-(methylideneamino)pent-4-enoic acid |
| SMILES | C=N/C(=C\NC)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C7H13N3O2/c1-9-4-5(10-2)3-6(8)7(11)12/h4,6,9H,2-3,8H2,1H3,(H,11,12)/b5-4-/t6-/m1/s1 |
| InChIKey | SUXPLZHBVJHYPN-WWVFMHICSA-N |
| XLogP | -0.45 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|