C6H12N2O6 — CID 18761839
2-aminoacetic acid;2-aminobutanedioic acid (PubChem CID 18761839) has the molecular formula C6H12N2O6 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-aminoacetic acid;2-aminobutanedioic acid.
| Compound Name | 2-aminoacetic acid;2-aminobutanedioic acid |
|---|---|
| PubChem CID | 18761839 |
| Molecular Formula | C6H12N2O6 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-aminoacetic acid;2-aminobutanedioic acid |
| SMILES | NC(CC(=O)O)C(=O)O.NCC(=O)O |
| InChI | InChI=1S/C4H7NO4.C2H5NO2/c5-2(4(8)9)1-3(6)7;3-1-2(4)5/h2H,1,5H2,(H,6,7)(H,8,9);1,3H2,(H,4,5) |
| InChIKey | FOWNDZJYGGTHRO-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |