About 3-(methylamino)heptane-2,5-dione
3-(methylamino)heptane-2,5-dione (PubChem CID 121263911) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-(methylamino)heptane-2,5-dione.
Molecular Properties
| Compound Name | 3-(methylamino)heptane-2,5-dione |
| PubChem CID | 121263911 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-(methylamino)heptane-2,5-dione |
| SMILES | CCC(=O)CC(NC)C(C)=O |
| InChI | InChI=1S/C8H15NO2/c1-4-7(11)5-8(9-3)6(2)10/h8-9H,4-5H2,1-3H3 |
| InChIKey | NFSCOJZRGMFTHM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(methylamino)heptane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)heptane-2,5-dione?
The IUPAC name of 3-(methylamino)heptane-2,5-dione (CID 121263911) is 3-(methylamino)heptane-2,5-dione.
What is the SMILES notation for 3-(methylamino)heptane-2,5-dione?
The canonical SMILES for 3-(methylamino)heptane-2,5-dione is CCC(=O)CC(NC)C(C)=O.
What is the InChIKey of 3-(methylamino)heptane-2,5-dione?
The InChIKey is NFSCOJZRGMFTHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-4-7(11)5-8(9-3)6(2)10/h8-9H,4-5H2,1-3H3.
What are the key properties of 3-(methylamino)heptane-2,5-dione?
3-(methylamino)heptane-2,5-dione has a molecular weight of 157.21 g/mol, XLogP of 0.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)heptane-2,5-dione is sourced from PubChem (CID 121263911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).