C8H15NO2 — CID 121263911
3-(methylamino)heptane-2,5-dione (PubChem CID 121263911) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 3-(methylamino)heptane-2,5-dione.
| Compound Name | 3-(methylamino)heptane-2,5-dione |
|---|---|
| PubChem CID | 121263911 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 3-(methylamino)heptane-2,5-dione |
| SMILES | CCC(=O)CC(NC)C(C)=O |
| InChI | InChI=1S/C8H15NO2/c1-4-7(11)5-8(9-3)6(2)10/h8-9H,4-5H2,1-3H3 |
| InChIKey | NFSCOJZRGMFTHM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |