C9H16O2 — CID 14711976
4-methyloctane-3,6-dione (PubChem CID 14711976) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 4-methyloctane-3,6-dione.
| Compound Name | 4-methyloctane-3,6-dione |
|---|---|
| PubChem CID | 14711976 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 4-methyloctane-3,6-dione |
| SMILES | CCC(=O)CC(C)C(=O)CC |
| InChI | InChI=1S/C9H16O2/c1-4-8(10)6-7(3)9(11)5-2/h7H,4-6H2,1-3H3 |
| InChIKey | ASTBPGXZRQKVQX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |