C8H12F3NO2 — CID 135189834
(5S)-1,1,1-trifluoro-5-(methylamino)heptane-2,6-dione (PubChem CID 135189834) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is (5S)-1,1,1-trifluoro-5-(methylamino)heptane-2,6-dione.
| Compound Name | (5S)-1,1,1-trifluoro-5-(methylamino)heptane-2,6-dione |
|---|---|
| PubChem CID | 135189834 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (5S)-1,1,1-trifluoro-5-(methylamino)heptane-2,6-dione |
| SMILES | CN[C@@H](CCC(=O)C(F)(F)F)C(C)=O |
| InChI | InChI=1S/C8H12F3NO2/c1-5(13)6(12-2)3-4-7(14)8(9,10)11/h6,12H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | CPEOKDPLXFGTKF-LURJTMIESA-N |
| XLogP | 1.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |