C12H21NO3 — CID 135199892
(3S)-9-methyl-3-(methylamino)decane-2,6,7-trione (PubChem CID 135199892) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (3S)-9-methyl-3-(methylamino)decane-2,6,7-trione.
| Compound Name | (3S)-9-methyl-3-(methylamino)decane-2,6,7-trione |
|---|---|
| PubChem CID | 135199892 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (3S)-9-methyl-3-(methylamino)decane-2,6,7-trione |
| SMILES | CN[C@@H](CCC(=O)C(=O)CC(C)C)C(C)=O |
| InChI | InChI=1S/C12H21NO3/c1-8(2)7-12(16)11(15)6-5-10(13-4)9(3)14/h8,10,13H,5-7H2,1-4H3/t10-/m0/s1 |
| InChIKey | CVGWCCJGXTVKCZ-JTQLQIEISA-N |
| XLogP | 1.13 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|