C10H20N2O2 — CID 172944980
(3S,6E)-6-methoxyimino-3-(methylamino)octan-2-one (PubChem CID 172944980) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3S,6E)-6-methoxyimino-3-(methylamino)octan-2-one.
| Compound Name | (3S,6E)-6-methoxyimino-3-(methylamino)octan-2-one |
|---|---|
| PubChem CID | 172944980 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (3S,6E)-6-methoxyimino-3-(methylamino)octan-2-one |
| SMILES | CC/C(CC[C@H](NC)C(C)=O)=N\OC |
| InChI | InChI=1S/C10H20N2O2/c1-5-9(12-14-4)6-7-10(11-3)8(2)13/h10-11H,5-7H2,1-4H3/b12-9+/t10-/m0/s1 |
| InChIKey | GUULXMXWZTZGBN-LZAIMSLLSA-N |
| XLogP | 1.36 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|