C14H27NO2 — CID 167423974
2,2,8,8-tetramethyl-4-(methylamino)nonane-3,7-dione (PubChem CID 167423974) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2,2,8,8-tetramethyl-4-(methylamino)nonane-3,7-dione.
| Compound Name | 2,2,8,8-tetramethyl-4-(methylamino)nonane-3,7-dione |
|---|---|
| PubChem CID | 167423974 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2,2,8,8-tetramethyl-4-(methylamino)nonane-3,7-dione |
| SMILES | CNC(CCC(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H27NO2/c1-13(2,3)11(16)9-8-10(15-7)12(17)14(4,5)6/h10,15H,8-9H2,1-7H3 |
| InChIKey | YGEAHBISRSDIKO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |