C11H20O2 — CID 87142826
5,7,7-trimethyloctane-2,6-dione (PubChem CID 87142826) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 5,7,7-trimethyloctane-2,6-dione.
| Compound Name | 5,7,7-trimethyloctane-2,6-dione |
|---|---|
| PubChem CID | 87142826 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 5,7,7-trimethyloctane-2,6-dione |
| SMILES | CC(=O)CCC(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20O2/c1-8(6-7-9(2)12)10(13)11(3,4)5/h8H,6-7H2,1-5H3 |
| InChIKey | POPFPFMLLOBRMO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |