C13H26O — CID 162023724
ethene;2,2,4-trimethyloctan-3-one (PubChem CID 162023724) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is ethene;2,2,4-trimethyloctan-3-one.
| Compound Name | ethene;2,2,4-trimethyloctan-3-one |
|---|---|
| PubChem CID | 162023724 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | ethene;2,2,4-trimethyloctan-3-one |
| SMILES | C=C.CCCCC(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22O.C2H4/c1-6-7-8-9(2)10(12)11(3,4)5;1-2/h9H,6-8H2,1-5H3;1-2H2 |
| InChIKey | YVBXPGBVZQDHAH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|