C16H30O3 — CID 98117104
(3R,5S)-3-hydroxy-3,5-dimethyltetradecane-2,4-dione (PubChem CID 98117104) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (3R,5S)-3-hydroxy-3,5-dimethyltetradecane-2,4-dione.
| Compound Name | (3R,5S)-3-hydroxy-3,5-dimethyltetradecane-2,4-dione |
|---|---|
| PubChem CID | 98117104 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (3R,5S)-3-hydroxy-3,5-dimethyltetradecane-2,4-dione |
| SMILES | CCCCCCCCC[C@H](C)C(=O)[C@](C)(O)C(C)=O |
| InChI | InChI=1S/C16H30O3/c1-5-6-7-8-9-10-11-12-13(2)15(18)16(4,19)14(3)17/h13,19H,5-12H2,1-4H3/t13-,16+/m0/s1 |
| InChIKey | PXFMOEBRFVMCMS-XJKSGUPXSA-N |
| XLogP | 3.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|