(4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen

C12H29NO — CID 177241681

IUPAC(4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen
SMILESCC.CCCC[C@H](N)C(=O)C(C)(C)C.[H][H]
InChIInChI=1S/C10H21NO.C2H6.H2/c1-5-6-7-8(11)9(12)10(2,3)4;1-2;/h8H,5-7,11H2,1-4H3;1-2H3;1H/t8-;;/m0../s1
InChIKeyGNUMDGGSMZQWAC-JZGIKJSDSA-N
MW203.37 g/mol
LogP3.39
Rot. Bonds4

About (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen

(4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen (PubChem CID 177241681) has the molecular formula C12H29NO and a molecular weight of 203.37 g/mol. Its IUPAC name is (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen.

Molecular Properties

Compound Name(4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen
PubChem CID177241681
Molecular FormulaC12H29NO
Molecular Weight203.37 g/mol
Exact Mass203.22
IUPAC Name(4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen
SMILESCC.CCCC[C@H](N)C(=O)C(C)(C)C.[H][H]
InChIInChI=1S/C10H21NO.C2H6.H2/c1-5-6-7-8(11)9(12)10(2,3)4;1-2;/h8H,5-7,11H2,1-4H3;1-2H3;1H/t8-;;/m0../s1
InChIKeyGNUMDGGSMZQWAC-JZGIKJSDSA-N
XLogP3.39
TPSA43.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.37
LogP ≤ 53.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen?
The IUPAC name of (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen (CID 177241681) is (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen.
What is the SMILES notation for (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen?
The canonical SMILES for (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen is CC.CCCC[C@H](N)C(=O)C(C)(C)C.[H][H].
What is the InChIKey of (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen?
The InChIKey is GNUMDGGSMZQWAC-JZGIKJSDSA-N. The full InChI is InChI=1S/C10H21NO.C2H6.H2/c1-5-6-7-8(11)9(12)10(2,3)4;1-2;/h8H,5-7,11H2,1-4H3;1-2H3;1H/t8-;;/m0../s1.
What are the key properties of (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen?
(4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen has a molecular weight of 203.37 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-amino-2,2-dimethyloctan-3-one;ethane;molecular hydrogen is sourced from PubChem (CID 177241681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).