C12H25NO — CID 167383271
(4S)-4-amino-2,2,7,7-tetramethyloctan-3-one (PubChem CID 167383271) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (4S)-4-amino-2,2,7,7-tetramethyloctan-3-one.
| Compound Name | (4S)-4-amino-2,2,7,7-tetramethyloctan-3-one |
|---|---|
| PubChem CID | 167383271 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (4S)-4-amino-2,2,7,7-tetramethyloctan-3-one |
| SMILES | CC(C)(C)CC[C@H](N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H25NO/c1-11(2,3)8-7-9(13)10(14)12(4,5)6/h9H,7-8,13H2,1-6H3/t9-/m0/s1 |
| InChIKey | UISOQFHLEHALID-VIFPVBQESA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |