C14H27NO — CID 142239634
4-amino-2,2-dimethyl-6-(1-methylcyclopentyl)hexan-3-one (PubChem CID 142239634) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 4-amino-2,2-dimethyl-6-(1-methylcyclopentyl)hexan-3-one.
| Compound Name | 4-amino-2,2-dimethyl-6-(1-methylcyclopentyl)hexan-3-one |
|---|---|
| PubChem CID | 142239634 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 4-amino-2,2-dimethyl-6-(1-methylcyclopentyl)hexan-3-one |
| SMILES | CC1(CCC(N)C(=O)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C14H27NO/c1-13(2,3)12(16)11(15)7-10-14(4)8-5-6-9-14/h11H,5-10,15H2,1-4H3 |
| InChIKey | BOZBMEDSKJXINC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |