C9H20NO3P — CID 155787758
(3-amino-5,5-dimethyl-4-oxohexyl)-methylphosphinic acid (PubChem CID 155787758) has the molecular formula C9H20NO3P and a molecular weight of 221.24 g/mol. Its IUPAC name is (3-amino-5,5-dimethyl-4-oxohexyl)-methylphosphinic acid.
| Compound Name | (3-amino-5,5-dimethyl-4-oxohexyl)-methylphosphinic acid |
|---|---|
| PubChem CID | 155787758 |
| Molecular Formula | C9H20NO3P |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3-amino-5,5-dimethyl-4-oxohexyl)-methylphosphinic acid |
| SMILES | CC(C)(C)C(=O)C(N)CCP(C)(=O)O |
| InChI | InChI=1S/C9H20NO3P/c1-9(2,3)8(11)7(10)5-6-14(4,12)13/h7H,5-6,10H2,1-4H3,(H,12,13) |
| InChIKey | AKXQQJURRCSSHQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|