C12H24N2O — CID 163441326
(4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one (PubChem CID 163441326) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one.
| Compound Name | (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one |
|---|---|
| PubChem CID | 163441326 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one |
| SMILES | C=C(N)CCCC[C@@H](N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O/c1-9(13)7-5-6-8-10(14)11(15)12(2,3)4/h10H,1,5-8,13-14H2,2-4H3/t10-/m1/s1 |
| InChIKey | UYIKOCQIIHVJAM-SNVBAGLBSA-N |
| XLogP | 1.96 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|