About (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one
(4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one (PubChem CID 163441326) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one.
Molecular Properties
| Compound Name | (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one |
| PubChem CID | 163441326 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one |
| SMILES | C=C(N)CCCC[C@@H](N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O/c1-9(13)7-5-6-8-10(14)11(15)12(2,3)4/h10H,1,5-8,13-14H2,2-4H3/t10-/m1/s1 |
| InChIKey | UYIKOCQIIHVJAM-SNVBAGLBSA-N |
| XLogP | 1.96 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one?
The IUPAC name of (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one (CID 163441326) is (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one.
What is the SMILES notation for (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one?
The canonical SMILES for (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one is C=C(N)CCCC[C@@H](N)C(=O)C(C)(C)C.
What is the InChIKey of (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one?
The InChIKey is UYIKOCQIIHVJAM-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H24N2O/c1-9(13)7-5-6-8-10(14)11(15)12(2,3)4/h10H,1,5-8,13-14H2,2-4H3/t10-/m1/s1.
What are the key properties of (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one?
(4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one has a molecular weight of 212.34 g/mol, XLogP of 1.96, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,9-diamino-2,2-dimethyldec-9-en-3-one is sourced from PubChem (CID 163441326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).