C15H30O2 — CID 153306790
(4R)-4-hydroxy-2,2,5,5,8,8-hexamethylnonan-3-one (PubChem CID 153306790) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is (4R)-4-hydroxy-2,2,5,5,8,8-hexamethylnonan-3-one.
| Compound Name | (4R)-4-hydroxy-2,2,5,5,8,8-hexamethylnonan-3-one |
|---|---|
| PubChem CID | 153306790 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | (4R)-4-hydroxy-2,2,5,5,8,8-hexamethylnonan-3-one |
| SMILES | CC(C)(C)CCC(C)(C)[C@@H](O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H30O2/c1-13(2,3)9-10-15(7,8)12(17)11(16)14(4,5)6/h12,17H,9-10H2,1-8H3/t12-/m0/s1 |
| InChIKey | MUIQNVSXWSJBMU-LBPRGKRZSA-N |
| XLogP | 3.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |