C8H18O3 — CID 160834732
(2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane (PubChem CID 160834732) has the molecular formula C8H18O3 and a molecular weight of 162.23 g/mol. Its IUPAC name is (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane.
| Compound Name | (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane |
|---|---|
| PubChem CID | 160834732 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane |
| SMILES | C.CC(C)(C)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C7H14O3.CH4/c1-7(2,3)6(10)5(9)4-8;/h5,8-9H,4H2,1-3H3;1H4/t5-;/m1./s1 |
| InChIKey | SHGMNVFPWYUPSL-NUBCRITNSA-N |
| XLogP | 0.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |