About (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane
(2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane (PubChem CID 160834732) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane.
Molecular Properties
| Compound Name | (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane |
| PubChem CID | 160834732 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane |
| SMILES | C.CC(C)(C)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C7H14O3.CH4/c1-7(2,3)6(10)5(9)4-8;/h5,8-9H,4H2,1-3H3;1H4/t5-;/m1./s1 |
| InChIKey | SHGMNVFPWYUPSL-NUBCRITNSA-N |
| XLogP | 0.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane?
The IUPAC name of (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane (CID 160834732) is (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane.
What is the SMILES notation for (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane?
The canonical SMILES for (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane is C.CC(C)(C)C(=O)[C@H](O)CO.
What is the InChIKey of (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane?
The InChIKey is SHGMNVFPWYUPSL-NUBCRITNSA-N. The full InChI is InChI=1S/C7H14O3.CH4/c1-7(2,3)6(10)5(9)4-8;/h5,8-9H,4H2,1-3H3;1H4/t5-;/m1./s1.
What are the key properties of (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane?
(2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane has a molecular weight of 162.23 g/mol, XLogP of 0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2-dihydroxy-4,4-dimethylpentan-3-one;methane is sourced from PubChem (CID 160834732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).