C12H24O2 — CID 153306609
(4S)-4-(hydroxymethyl)-2,2,7-trimethyloctan-3-one (PubChem CID 153306609) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (4S)-4-(hydroxymethyl)-2,2,7-trimethyloctan-3-one.
| Compound Name | (4S)-4-(hydroxymethyl)-2,2,7-trimethyloctan-3-one |
|---|---|
| PubChem CID | 153306609 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (4S)-4-(hydroxymethyl)-2,2,7-trimethyloctan-3-one |
| SMILES | CC(C)CC[C@@H](CO)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H24O2/c1-9(2)6-7-10(8-13)11(14)12(3,4)5/h9-10,13H,6-8H2,1-5H3/t10-/m0/s1 |
| InChIKey | FODDZTCXLQEJSE-JTQLQIEISA-N |
| XLogP | 2.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |